|
CAS#: 5054-57-9 Product: Nifenalol No suppilers available for the product. |
| Name | Nifenalol |
|---|---|
| Synonyms | 2-(Isopropylamino)-1-(4-Nitrophenyl)Ethanol; Alpha-((Isopropylamino)Methyl)-P-Nitrobenzyl Alcohol; Oprea1_127426 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 |
| CAS Registry Number | 5054-57-9 |
| SMILES | C1=C(C=CC(=C1)[N+](=O)[O-])C(CNC(C)C)O |
| InChI | 1S/C11H16N2O3/c1-8(2)12-7-11(14)9-3-5-10(6-4-9)13(15)16/h3-6,8,11-12,14H,7H2,1-2H3 |
| InChIKey | UAORFCGRZIGNCI-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.392°C at 760 mmHg (Cal.) |
| Flash point | 182.04°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nifenalol |