Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | O-Trimethylsilyltestosterone |
|---|---|
| Synonyms | Androst-4-En-3-One, 17Beta-(Trimethylsiloxy)- (8Ci); Nsc 95147 |
| Molecular Structure |  |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 |
| CAS Registry Number | 5055-42-5 |
| EINECS | 225-755-5 |
| SMILES | [C@@H]23[C@H]([C@H]1[C@]([C@@H](O[Si](C)(C)C)CC1)(C)CC2)CCC4=CC(=O)CC[C@]34C |
| InChI | 1S/C22H36O2Si/c1-21-12-10-16(23)14-15(21)6-7-17-18-8-9-20(24-25(3,4)5)22(18,2)13-11-19(17)21/h14,17-20H,6-13H2,1-5H3/t17-,18-,19-,20-,21-,22-/m0/s1 |
| InChIKey | HNZDTAXZHUDITM-WLNPFYQQSA-N |
| Density | 1.031g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.075°C at 760 mmHg (Cal.) |
| Flash point | 176.71°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-Trimethylsilyltestosterone |