|
CAS#: 50585-43-8 Product: 2,3-Dibromo-7,8-Difluorodibenzo-p-Dioxin No suppilers available for the product. |
| Name | 2,3-Dibromo-7,8-Difluorodibenzo-p-Dioxin |
|---|---|
| Synonyms | 2,3-Dibromo-7,8-Difluoro-Oxanthrene; 2,3-Dibromo-7,8-Difluorodibenzo-P-Dioxin |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4Br2F2O2 |
| Molecular Weight | 377.97 |
| CAS Registry Number | 50585-43-8 |
| SMILES | C1=C(Br)C(=CC2=C1OC3=C(O2)C=C(C(=C3)F)F)Br |
| InChI | 1S/C12H4Br2F2O2/c13-5-1-9-10(2-6(5)14)18-12-4-8(16)7(15)3-11(12)17-9/h1-4H |
| InChIKey | OYZFZUIMCOBMIR-UHFFFAOYSA-N |
| Density | 2g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.296°C at 760 mmHg (Cal.) |
| Flash point | 214.312°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dibromo-7,8-Difluorodibenzo-p-Dioxin |