|
CAS#: 50615-41-3 Product: 3-(2-Carboxyethyl)Cytosine No suppilers available for the product. |
| Name | 3-(2-Carboxyethyl)Cytosine |
|---|---|
| Synonyms | 3-(6-Amino-2-Oxo-Pyrimidin-1-Yl)Propanoic Acid; 3-(6-Amino-2-Oxo-1-Pyrimidinyl)Propanoic Acid; 3-(6-Amino-2-Keto-Pyrimidin-1-Yl)Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 |
| CAS Registry Number | 50615-41-3 |
| SMILES | C(N1C(=O)N=CC=C1N)CC(O)=O |
| InChI | 1S/C7H9N3O3/c8-5-1-3-9-7(13)10(5)4-2-6(11)12/h1,3H,2,4,8H2,(H,11,12) |
| InChIKey | WYZGJTDHNAZBRC-UHFFFAOYSA-N |
| Density | 1.515g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.588°C at 760 mmHg (Cal.) |
| Flash point | 191.835°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Carboxyethyl)Cytosine |