|
CAS#: 50712-64-6 Product: Ethyl 2-(4-Nitrophenyl)Propionate No suppilers available for the product. |
| Name | Ethyl 2-(4-Nitrophenyl)Propionate |
|---|---|
| Synonyms | 2-(4-Nitrophenyl)Propanoic Acid Ethyl Ester; 2-(4-Nitrophenyl)Propionic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 50712-64-6 |
| EINECS | 256-732-8 |
| SMILES | C1=C(C(C(OCC)=O)C)C=CC(=C1)[N+](=O)[O-] |
| InChI | 1S/C11H13NO4/c1-3-16-11(13)8(2)9-4-6-10(7-5-9)12(14)15/h4-8H,3H2,1-2H3 |
| InChIKey | GMOOHUQPPFJAQB-UHFFFAOYSA-N |
| Density | 1.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.633°C at 760 mmHg (Cal.) |
| Flash point | 134.457°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-(4-Nitrophenyl)Propionate |