|
CAS#: 5075-13-8 Product: O-Ethyl Phenylchloridothiophosphonate No suppilers available for the product. |
| Name | O-Ethyl Phenylchloridothiophosphonate |
|---|---|
| Synonyms | Chloro-Ethoxy-Phenyl-Thioxo-Phosphorane; Chloro-Ethoxy-Phenyl-Thioxophosphorane; Chloro-Ethoxy-Phenyl-Sulfanylidene-Phosphorane |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10ClOPS |
| Molecular Weight | 220.65 |
| CAS Registry Number | 5075-13-8 |
| EINECS | 225-781-7 |
| SMILES | C1=CC=CC=C1[P](Cl)(=S)OCC |
| InChI | 1S/C8H10ClOPS/c1-2-10-11(9,12)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | FVIHUXZNJJCGPC-UHFFFAOYSA-N |
| Density | 1.261g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.588°C at 760 mmHg (Cal.) |
| Flash point | 119.867°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-Ethyl Phenylchloridothiophosphonate |