|
CAS#: 50793-87-8 Product: 4-Cyanophenyl 4-(Hexyloxy)Benzoate No suppilers available for the product. |
| Name | 4-Cyanophenyl 4-(Hexyloxy)Benzoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 |
| CAS Registry Number | 50793-87-8 |
| SMILES | CCCCCCOc1ccc(cc1)C(=O)Oc2ccc(cc2)C#N |
| InChI | 1S/C20H21NO3/c1-2-3-4-5-14-23-18-12-8-17(9-13-18)20(22)24-19-10-6-16(15-21)7-11-19/h6-13H,2-5,14H2,1H3 |
| InChIKey | JSPWLPBBQHWZNH-UHFFFAOYSA-N |
| Density | 1.142g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.909°C at 760 mmHg (Cal.) |
| Flash point | 211.571°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Cyanophenyl 4-(Hexyloxy)Benzoate |