|
CAS#: 5081-02-7 Product: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-Icosafluoroundecanoic Acid Ammonium Salt No suppilers available for the product. |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-Icosafluoroundecanoic Acid Ammonium Salt |
|---|---|
| Synonyms | Ammonium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-Icosafluoroundecanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H5F20NO2 |
| Molecular Weight | 563.13 |
| CAS Registry Number | 5081-02-7 |
| EINECS | 225-792-7 |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.[NH4+] |
| InChI | 1S/C11H2F20O2.H3N/c12-1(13)3(14,15)5(18,19)7(22,23)9(26,27)11(30,31)10(28,29)8(24,25)6(20,21)4(16,17)2(32)33;/h1H,(H,32,33);1H3 |
| InChIKey | IFECPNPXOCVGRS-UHFFFAOYSA-N |
| Boiling point | 249.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 104.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-Icosafluoroundecanoic Acid Ammonium Salt |