|
CAS#: 50823-94-4 Product: 5-[M-(Trifluoromethyl)Benzyl]-2,4-Pyrimidinediamine No suppilers available for the product. |
| Name | 5-[M-(Trifluoromethyl)Benzyl]-2,4-Pyrimidinediamine |
|---|---|
| Synonyms | [2-Amino-5-[3-(Trifluoromethyl)Benzyl]Pyrimidin-4-Yl]Amine; 2,4-Pyrimidinediamine, 5-((3-(Trifluoromethyl)Phenyl)Methyl)-; 5-25-12-00254 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11F3N4 |
| Molecular Weight | 268.24 |
| CAS Registry Number | 50823-94-4 |
| SMILES | C2=C(CC1=CN=C(N=C1N)N)C=CC=C2C(F)(F)F |
| InChI | 1S/C12H11F3N4/c13-12(14,15)9-3-1-2-7(5-9)4-8-6-18-11(17)19-10(8)16/h1-3,5-6H,4H2,(H4,16,17,18,19) |
| InChIKey | ULJLXZHDPJDSAN-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.802°C at 760 mmHg (Cal.) |
| Flash point | 219.18°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[M-(Trifluoromethyl)Benzyl]-2,4-Pyrimidinediamine |