|
CAS#: 50852-77-2 Product: 2,2-Dichloroethenylbenzene No suppilers available for the product. |
| Name | 2,2-Dichloroethenylbenzene |
|---|---|
| Synonyms | 2,2-Dichlorovinylbenzene; Benzene, (2,2-Dichloroethenyl)-; Inchi=1/C8h6cl2/C9-8(10)6-7-4-2-1-3-5-7/H1-6 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6Cl2 |
| Molecular Weight | 173.04 |
| CAS Registry Number | 50852-77-2 |
| SMILES | C1=C(C=C(Cl)Cl)C=CC=C1 |
| InChI | 1S/C8H6Cl2/c9-8(10)6-7-4-2-1-3-5-7/h1-6H |
| InChIKey | CISIJYCKDJSTMX-UHFFFAOYSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 224.999°C at 760 mmHg (Cal.) |
| Flash point | 90.175°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dichloroethenylbenzene |