|
CAS#: 509-71-7 Product: Dihydroheroine No suppilers available for the product. |
| Name | Dihydroheroine |
|---|---|
| Synonyms | Dihydroheroin; Morphinan-3,6-Alpha-Diol, 4,5A-Epoxy-17-Methyl-, Diacetate (Ester); Morphine, Dihydro-, Diacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 |
| CAS Registry Number | 509-71-7 |
| SMILES | [C@@]125C3=C4C[C@H]([C@@H]1CC[C@@H]([C@@H]2OC3=C(C=C4)OC(C)=O)OC(C)=O)N(C)CC5 |
| InChI | 1S/C21H25NO5/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20/h4,6,14-15,17,20H,5,7-10H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1 |
| InChIKey | NCXVKLDKUADJPV-PVHGPHFFSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 254.3±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihydroheroine |