|
CAS#: 5090-88-0 Product: 3,6,9-Trimethylnaphtho[1,8-bc]Pyran-7,8-Dione No suppilers available for the product. |
| Name | 3,6,9-Trimethylnaphtho[1,8-bc]Pyran-7,8-Dione |
|---|---|
| Synonyms | Mansonone F; Nsc 113136; Naphtho(1,8-Bc)Pyran-7,8-Dione, 3,6,9-Trimethyl- (8Ci)(9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 5090-88-0 |
| SMILES | C1=CC(=C3C2=C1C(=COC2=C(C(=O)C3=O)C)C)C |
| InChI | 1S/C15H12O3/c1-7-4-5-10-8(2)6-18-15-9(3)13(16)14(17)11(7)12(10)15/h4-6H,1-3H3 |
| InChIKey | WSRLWSPFIOAYST-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.458°C at 760 mmHg (Cal.) |
| Flash point | 197.118°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6,9-Trimethylnaphtho[1,8-bc]Pyran-7,8-Dione |