|
CAS#: 50984-69-5 Product: 4,4'-Diamino-(1,1'-Biphenyl)Diol No suppilers available for the product. |
| Name | 4,4'-Diamino-(1,1'-Biphenyl)Diol |
|---|---|
| Synonyms | 3-Amino-6-(4-Aminophenyl)Pyrocatechol; (1,1'-Biphenyl)Diol, 4,4'-Diamino-; 4,4'-Diamino-(1,1'-Biphenyl)Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 |
| CAS Registry Number | 50984-69-5 |
| SMILES | C1=C(C(=C(O)C(=C1)N)O)C2=CC=C(N)C=C2 |
| InChI | 1S/C12H12N2O2/c13-8-3-1-7(2-4-8)9-5-6-10(14)12(16)11(9)15/h1-6,15-16H,13-14H2 |
| InChIKey | DTHBNESGKSGIFM-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.18°C at 760 mmHg (Cal.) |
| Flash point | 206.103°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Diamino-(1,1'-Biphenyl)Diol |