|
CAS#: 51-13-8 Product: Behenyltrimethylammonium Methosulfate No suppilers available for the product. |
| Name | Behenyltrimethylammonium Methosulfate |
|---|---|
| Synonyms | 1-[(2-Chlorophenyl)Methyl]-2,3-Dimethyl-Guanidine; 1-[(2-Chlorophenyl)Methyl]-2,3-Dimethyl-Guanidine; Sulfuric Acid; 1-(2-Chlorobenzyl)-2,3-Dimethyl-Guanidine; 1-(2-Chlorobenzyl)-2,3-Dimethyl-Guanidine; Sulfuric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30Cl2N6O4S |
| Molecular Weight | 521.46 |
| CAS Registry Number | 51-13-8 |
| SMILES | C1=C(C(=CC=C1)Cl)CNC(=NC)NC.C2=C(C(=CC=C2)Cl)CNC(=NC)NC.O=[S](=O)(O)O |
| InChI | 1S/2C10H14ClN3.H2O4S/c2*1-12-10(13-2)14-7-8-5-3-4-6-9(8)11;1-5(2,3)4/h2*3-6H,7H2,1-2H3,(H2,12,13,14);(H2,1,2,3,4) |
| InChIKey | KHKPENDBCIDDOT-UHFFFAOYSA-N |
| Boiling point | 313.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 143.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Behenyltrimethylammonium Methosulfate |