|
CAS#: 5101-28-0 Product: 2-Phenylpyrene No suppilers available for the product. |
| Name | 2-Phenylpyrene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C22H14 |
| Molecular Weight | 278.35 |
| CAS Registry Number | 5101-28-0 |
| EINECS | 225-820-8 |
| SMILES | C2=C5C1=C4C(=CC=C1C=C2C3=CC=CC=C3)C=CC=C4C=C5 |
| InChI | 1S/C22H14/c1-2-5-15(6-3-1)20-13-18-11-9-16-7-4-8-17-10-12-19(14-20)22(18)21(16)17/h1-14H |
| InChIKey | CCIRWPQIFNLNMJ-UHFFFAOYSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.764°C at 760 mmHg (Cal.) |
| Flash point | 225.168°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenylpyrene |