|
CAS#: 51028-88-7 Product: 2'-Chloro-5-Methoxy-1,1'-Biphenyl-3-Acetic Acid No suppilers available for the product. |
| Name | 2'-Chloro-5-Methoxy-1,1'-Biphenyl-3-Acetic Acid |
|---|---|
| Synonyms | 2-[3-(2-Chlorophenyl)-5-Methoxy-Phenyl]Acetic Acid; 2-[3-(2-Chlorophenyl)-5-Methoxy-Phenyl]Ethanoic Acid; 2'-Chloro-5-Methoxy-3-Biphenylacetic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13ClO3 |
| Molecular Weight | 276.72 |
| CAS Registry Number | 51028-88-7 |
| SMILES | C1=C(CC(O)=O)C=C(C=C1OC)C2=C(C=CC=C2)Cl |
| InChI | 1S/C15H13ClO3/c1-19-12-7-10(8-15(17)18)6-11(9-12)13-4-2-3-5-14(13)16/h2-7,9H,8H2,1H3,(H,17,18) |
| InChIKey | QACBUFQVMMIRKQ-UHFFFAOYSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.139°C at 760 mmHg (Cal.) |
| Flash point | 209.707°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2'-Chloro-5-Methoxy-1,1'-Biphenyl-3-Acetic Acid |