| Name | 5-Nitro-o-Toluidinium Chloride |
|---|---|
| Synonyms | 2-Methyl-5-Nitro-Aniline Hydrochloride; (2-Methyl-5-Nitro-Phenyl)Amine Hydrochloride; 2-Methyl-5-Nitrobenzenamine, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 |
| CAS Registry Number | 51085-52-0 |
| EINECS | 256-960-8 |
| SMILES | [H+].C1=C(C(=CC(=C1)[N+]([O-])=O)N)C.[Cl-] |
| InChI | 1S/C7H8N2O2.ClH/c1-5-2-3-6(9(10)11)4-7(5)8;/h2-4H,8H2,1H3;1H |
| InChIKey | YTODVWJSAZXJHG-UHFFFAOYSA-N |
| Boiling point | 329.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 153°C (Cal.) |
| (1) | Sijia Xue, An Chai, Zhijuan Cai, Yongge Wei, Changsheng Xiang, Wangdong Bian and Jian Shen. A new class of functionalized polyoxometalates: synthesis, structure and preliminary antitumor activity studies of three arylimido substituted hexamolybdates bearing a strong electron-withdrawing nitro group, (BuN)[MoO(NAr)] (Ar = 3-NO-CH, 2-CH-4-NO-CH, 2-CH-5-NO-CH), Dalton Trans., 2008, 4770. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Nitro-o-Toluidinium Chloride |