|
CAS#: 51115-72-1 Product: 2-Isopropyl-N,N,2-Trimethylhexanamide No suppilers available for the product. |
| Name | 2-Isopropyl-N,N,2-Trimethylhexanamide |
|---|---|
| Synonyms | 2-Isopropyl-N,N,2-Trimethyl-Hexanamide; 2-Isopropyl-N,N,2-Trimethylhexanamide; N,N,2-Trimethyl-2-Propan-2-Yl-Hexanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 |
| CAS Registry Number | 51115-72-1 |
| EINECS | 256-980-7 |
| SMILES | C(C(C(=O)N(C)C)(C(C)C)C)CCC |
| InChI | 1S/C12H25NO/c1-7-8-9-12(4,10(2)3)11(14)13(5)6/h10H,7-9H2,1-6H3 |
| InChIKey | RNTPPLUFUHIOOM-UHFFFAOYSA-N |
| Density | 0.861g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.787°C at 760 mmHg (Cal.) |
| Flash point | 86.972°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isopropyl-N,N,2-Trimethylhexanamide |