|
CAS#: 51158-41-9 Product: Bis(1-Phenylethyl)Xylene No suppilers available for the product. |
| Name | Bis(1-Phenylethyl)Xylene |
|---|---|
| Synonyms | 1-Methyl-4-[2-Phenyl-1-(1-Phenylethyl)Propyl]Benzene; 1-[2,4-Di(Phenyl)Pentan-3-Yl]-4-Methyl-Benzene; Bis(1-Phenylethyl)Xylene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 |
| CAS Registry Number | 51158-41-9 |
| EINECS | 257-024-1 |
| SMILES | C1=CC(=CC=C1C(C(C2=CC=CC=C2)C)C(C3=CC=CC=C3)C)C |
| InChI | 1S/C24H26/c1-18-14-16-23(17-15-18)24(19(2)21-10-6-4-7-11-21)20(3)22-12-8-5-9-13-22/h4-17,19-20,24H,1-3H3 |
| InChIKey | KXNMMEVJUAYWHP-UHFFFAOYSA-N |
| Density | 1.009g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.796°C at 760 mmHg (Cal.) |
| Flash point | 186.894°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(1-Phenylethyl)Xylene |