|
CAS#: 51186-39-1 Product: 2-Methyl-3-Phenyl-L-Alanine Hydrogen Sulphate No suppilers available for the product. |
| Name | 2-Methyl-3-Phenyl-L-Alanine Hydrogen Sulphate |
|---|---|
| Synonyms | (2S)-2-Amino-3-(O-Tolyl)Propanoic Acid; Sulfuric Acid; (2S)-2-Amino-3-(O-Tolyl)Propionic Acid; Sulfuric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NO6S |
| Molecular Weight | 277.29 |
| CAS Registry Number | 51186-39-1 |
| EINECS | 257-039-3 |
| SMILES | [C@H](N)(CC1=CC=CC=C1C)C(=O)O.O=[S](=O)(O)O |
| InChI | 1S/C10H13NO2.H2O4S/c1-7-4-2-3-5-8(7)6-9(11)10(12)13;1-5(2,3)4/h2-5,9H,6,11H2,1H3,(H,12,13);(H2,1,2,3,4)/t9-;/m0./s1 |
| InChIKey | MYRFJBDNOSVJTE-FVGYRXGTSA-N |
| Boiling point | 326.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 151.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-3-Phenyl-L-Alanine Hydrogen Sulphate |