|
CAS#: 512-39-0 Product: 5,6-Monoepoxy Vitamin A No suppilers available for the product. |
| Name | 5,6-Monoepoxy Vitamin A |
|---|---|
| Synonyms | 5,6-Epoxy-5,6-Dihydroretinol; 5,6-Monoepoxy Vitamin A; 5,6-Monoepoxyretinal |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 |
| CAS Registry Number | 512-39-0 |
| SMILES | C(O)/C=C(/C=C/C=C(/C=C/C12OC1(CCCC2(C)C)C)C)C |
| InChI | 1S/C20H30O2/c1-16(8-6-9-17(2)11-15-21)10-14-20-18(3,4)12-7-13-19(20,5)22-20/h6,8-11,14,21H,7,12-13,15H2,1-5H3/b9-6+,14-10+,16-8+,17-11+ |
| InChIKey | XLRQASJLHKRLKG-JVSJJYLASA-N |
| Density | 1.043g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.985°C at 760 mmHg (Cal.) |
| Flash point | 166.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Monoepoxy Vitamin A |