|
CAS#: 51203-11-3 Product: 1-[(1,1-Dimethylethyl)Azo]-1-Methoxy-1,3-Dimethylbutane No suppilers available for the product. |
| Name | 1-[(1,1-Dimethylethyl)Azo]-1-Methoxy-1,3-Dimethylbutane |
|---|---|
| Synonyms | Tert-Butyl-(1-Methoxy-1,3-Dimethyl-Butyl)Diazene; Tert-Butyl-(1-Methoxy-1,3-Dimethylbutyl)Diazene; Tert-Butyl-(2-Methoxy-4-Methyl-Pentan-2-Yl)Diazene |
| Molecular Structure | ![]() |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.32 |
| CAS Registry Number | 51203-11-3 |
| SMILES | C(C(OC)(N=NC(C)(C)C)C)C(C)C |
| InChI | 1S/C11H24N2O/c1-9(2)8-11(6,14-7)13-12-10(3,4)5/h9H,8H2,1-7H3 |
| InChIKey | JZNXYMDOUSSHOV-UHFFFAOYSA-N |
| Density | 0.87g/cm3 (Cal.) |
|---|---|
| Boiling point | 213.259°C at 760 mmHg (Cal.) |
| Flash point | 70.607°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(1,1-Dimethylethyl)Azo]-1-Methoxy-1,3-Dimethylbutane |