Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Hexamethylphosphoric Triamide-D18 |
|---|---|
| Synonyms | Bis(Bis(Trideuteriomethyl)Amino)Phosphoryl-Bis(Trideuteriomethyl)Amine; Tris(Di(2H3)Methylamido)Phosphorus |
| Molecular Structure |  |
| Molecular Formula | C6D18N3OP |
| Molecular Weight | 197.31 |
| CAS Registry Number | 51219-90-0 |
| EINECS | 257-063-4 |
| SMILES | C(N([P](N(C([2H])([2H])[2H])C([2H])([2H])[2H])(N(C([2H])([2H])[2H])C([2H])([2H])[2H])=O)C([2H])([2H])[2H])([2H])([2H])[2H] |
| InChI | 1S/C6H18N3OP/c1-7(2)11(10,8(3)4)9(5)6/h1-6H3/i1D3,2D3,3D3,4D3,5D3,6D3 |
| InChIKey | GNOIPBMMFNIUFM-NBDUPMGQSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 233°C at 760 mmHg (Cal.) |
| Flash point | 94.716°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexamethylphosphoric Triamide-D18 |