|
CAS#: 51274-67-0 Product: 3-Hydroxy-2,5,2',5'-Tetrachlorobiphenyl No suppilers available for the product. |
| Name | 3-Hydroxy-2,5,2',5'-Tetrachlorobiphenyl |
|---|---|
| Synonyms | (1,1'-Biphenyl)-3-Ol, 2,2',5,5'-Tetrachloro-; 2,2',5,5'-Tetrachloro-(1,1'-Biphenyl)-3-Ol; 3-Htcbp |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl4O |
| Molecular Weight | 307.99 |
| CAS Registry Number | 51274-67-0 |
| SMILES | C1=C(C=C(C(=C1O)Cl)C2=CC(=CC=C2Cl)Cl)Cl |
| InChI | 1S/C12H6Cl4O/c13-6-1-2-10(15)8(3-6)9-4-7(14)5-11(17)12(9)16/h1-5,17H |
| InChIKey | SPZLUXZFGWFMRN-UHFFFAOYSA-N |
| Density | 1.533g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.558°C at 760 mmHg (Cal.) |
| Flash point | 186.979°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-2,5,2',5'-Tetrachlorobiphenyl |