| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| SelectLab Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (2383) 919-350 / 919-351 | |||
![]() |
info@selectlab.de, | |||
| Chemical manufacturer | ||||
| Vitas-M | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 4,6-Dinitrobenzofuroxane |
|---|---|
| Synonyms | 4,6-Dinitro-1-Oxido-Benzofurazan-1-Ium; 2,1,3-Benzoxadiazole, 4,6-Dinitro-, 1-Oxide; Benzofurazan, 4,6-Dinitro-, 1-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2N4O6 |
| Molecular Weight | 226.11 |
| CAS Registry Number | 5128-28-9 |
| SMILES | C2=C([N+](=O)[O-])C1=NO[N+](=C1C=C2[N+](=O)[O-])[O-] |
| InChI | 1S/C6H2N4O6/c11-8(12)3-1-4(9(13)14)6-5(2-3)10(15)16-7-6/h1-2H |
| InChIKey | YHBBUAULQKLKMW-UHFFFAOYSA-N |
| Density | 2.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.448°C at 760 mmHg (Cal.) |
| Flash point | 215.942°C (Cal.) |
| (1) | Erwin Buncel and François Terrier. Assessing the superelectrophilic dimension through σ-complexation, SNAr, Org. Biomol. Chem., 2010, 8, 2285. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,6-Dinitrobenzofuroxane |