|
CAS#: 51308-78-2 Product: S-((4-Chlorophenyl)Methyl) O-(2-Methylpropyl) 3-Pyridinylcarbonimidothioate No suppilers available for the product. |
| Name | S-((4-Chlorophenyl)Methyl) O-(2-Methylpropyl) 3-Pyridinylcarbonimidothioate |
|---|---|
| Synonyms | S-[(4-Chlorophenyl)Methyl] [(2-Isobutyl-3-Pyridyl)Amino]Methanethioate; [(2-Isobutyl-3-Pyridyl)Amino]Methanethioic Acid S-[(4-Chlorophenyl)Methyl] Ester; [(2-Isobutyl-3-Pyridyl)Amino]Methanethioic Acid S-(4-Chlorobenzyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19ClN2OS |
| Molecular Weight | 334.86 |
| CAS Registry Number | 51308-78-2 |
| SMILES | C2=C(NC(=O)SCC1=CC=C(C=C1)Cl)C(=NC=C2)CC(C)C |
| InChI | 1S/C17H19ClN2OS/c1-12(2)10-16-15(4-3-9-19-16)20-17(21)22-11-13-5-7-14(18)8-6-13/h3-9,12H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | DTJWGDQEBCZIHH-UHFFFAOYSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for S-((4-Chlorophenyl)Methyl) O-(2-Methylpropyl) 3-Pyridinylcarbonimidothioate |