|
CAS#: 51325-28-1 Product: Trinitrophloroglucinol, Lead Salt No suppilers available for the product. |
| Name | Trinitrophloroglucinol, Lead Salt |
|---|---|
| Synonyms | Plumbous 4,6-Dinitro-5-Nitrooxy-Benzene-1,3-Diolate; Plumbous 4,6-Dinitro-5-Nitrooxybenzene-1,3-Diolate; 4,6-Dinitro-5-Nitrooxy-Benzene-1,3-Diolate; Lead(+2) Cation |
| Molecular Structure | ![]() |
| Molecular Formula | C6HN3O9Pb |
| Molecular Weight | 466.29 |
| CAS Registry Number | 51325-28-1 |
| EINECS | 257-135-5 |
| SMILES | C1=C([O-])C(=C(O[N+]([O-])=O)C(=C1[O-])[N+]([O-])=O)[N+]([O-])=O.[Pb++] |
| InChI | 1S/C6H3N3O9.Pb/c10-2-1-3(11)5(8(14)15)6(18-9(16)17)4(2)7(12)13;/h1,10-11H;/q;+2/p-2 |
| InChIKey | DYBOXUYDURGBIH-UHFFFAOYSA-L |
| Boiling point | 466.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 236.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trinitrophloroglucinol, Lead Salt |