|
CAS#: 51360-19-1 Product: 2-Hydroxy-4-Phosphonobutyric Acid No suppilers available for the product. |
| Name | 2-Hydroxy-4-Phosphonobutyric Acid |
|---|---|
| Synonyms | 2-Hydroxy-4-Phosphono-Butanoic Acid; 2-Hydroxy-4-Phosphono-Butyric Acid; 2-Hydroxy-4-Phosphonobutyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C4H9O6P |
| Molecular Weight | 184.09 |
| CAS Registry Number | 51360-19-1 |
| SMILES | C([P](O)(O)=O)CC(O)C(O)=O |
| InChI | 1S/C4H9O6P/c5-3(4(6)7)1-2-11(8,9)10/h3,5H,1-2H2,(H,6,7)(H2,8,9,10) |
| InChIKey | KXCAWHBVEPNIQX-UHFFFAOYSA-N |
| Density | 1.733g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.923°C at 760 mmHg (Cal.) |
| Flash point | 295.455°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-4-Phosphonobutyric Acid |