| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Name | 2-(4-Isobutylphenyl)Propionaldehyde |
|---|---|
| Synonyms | 2-(4-Isobutylphenyl)Propanal; 2-(4-Isobutylphenyl)Propionaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 51407-46-6 |
| EINECS | 257-180-0 |
| SMILES | C1=C(C(C=O)C)C=CC(=C1)CC(C)C |
| InChI | 1S/C13H18O/c1-10(2)8-12-4-6-13(7-5-12)11(3)9-14/h4-7,9-11H,8H2,1-3H3 |
| InChIKey | DMZVZANOMJGHKO-UHFFFAOYSA-N |
| Density | 0.937g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.865°C at 760 mmHg (Cal.) |
| Flash point | 126.026°C (Cal.) |
| (1) | Giacomini Daria. Highly efficient asymmetric reduction of arylpropionic aldehydes by Horse Liver Alcohol Dehydrogenase through dynamic kinetic resolution, Chemical Communications, 2007 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(4-Isobutylphenyl)Propionaldehyde |