|
CAS#: 51419-12-6 Product: 4-[(Phenylsulphonyl)Oxy]Phthalic Acid No suppilers available for the product. |
| Name | 4-[(Phenylsulphonyl)Oxy]Phthalic Acid |
|---|---|
| Synonyms | 4-((Phenylsulphonyl)Oxy)Phthalic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O7S |
| Molecular Weight | 322.29 |
| CAS Registry Number | 51419-12-6 |
| EINECS | 257-194-7 |
| SMILES | C2=C(O[S](=O)(=O)C1=CC=CC=C1)C=CC(=C2C(=O)O)C(=O)O |
| InChI | 1S/C14H10O7S/c15-13(16)11-7-6-9(8-12(11)14(17)18)21-22(19,20)10-4-2-1-3-5-10/h1-8H,(H,15,16)(H,17,18) |
| InChIKey | HOWKEJQAUVTCTI-UHFFFAOYSA-N |
| Density | 1.548g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.485°C at 760 mmHg (Cal.) |
| Flash point | 304.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(Phenylsulphonyl)Oxy]Phthalic Acid |