|
CAS#: 515-12-8 Product: (1R,2S,4R)-1-Ethyl-2,4-Diisopropyl-1-Methylcyclohexane No suppilers available for the product. |
| Name | (1R,2S,4R)-1-Ethyl-2,4-Diisopropyl-1-Methylcyclohexane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 |
| CAS Registry Number | 515-12-8 |
| SMILES | CC[C@@]1(CC[C@H](C[C@H]1C(C)C)C(C)C)C |
| InChI | 1S/C15H30/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h11-14H,7-10H2,1-6H3/t13-,14+,15-/m1/s1 |
| InChIKey | MAVRWHAPLNZGKH-QLFBSQMISA-N |
| Density | 0.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.0±7.0°C at 760 mmHg (Cal.) |
| Flash point | 101.8±11.7°C (Cal.) |
| (1) | Braulio M. Fraga. Natural sesquiterpenoids, Nat. Prod. Rep., 2002, 19, 650. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1R,2S,4R)-1-Ethyl-2,4-Diisopropyl-1-Methylcyclohexane |