Online Database of Chemicals from Around the World
|
CAS#: 51556-30-0 Product: 2-Isopropyl-3-Methylbutyrophenone No suppilers available for the product. |
| Name | 2-Isopropyl-3-Methylbutyrophenone |
|---|---|
| Synonyms | 2-Isopropyl-3-Methyl-1-Phenyl-Butan-1-One; 2-Isopropyl-3-Methyl-1-Phenylbutan-1-One; 3-Methyl-1-Phenyl-2-Propan-2-Yl-Butan-1-One |
| Molecular Structure |  |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 |
| CAS Registry Number | 51556-30-0 |
| EINECS | 257-283-0 |
| SMILES | C1=CC=C(C=C1)C(=O)C(C(C)C)C(C)C |
| InChI | 1S/C14H20O/c1-10(2)13(11(3)4)14(15)12-8-6-5-7-9-12/h5-11,13H,1-4H3 |
| InChIKey | FYQORWFOIQDIHG-UHFFFAOYSA-N |
| Density | 0.924g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.418°C at 760 mmHg (Cal.) |
| Flash point | 111.249°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isopropyl-3-Methylbutyrophenone |