|
CAS#: 51584-96-4 Product: Polyribitol Phosphate No suppilers available for the product. |
| Name | Polyribitol Phosphate |
|---|---|
| Synonyms | [(2R,3S,4R)-2,3,4,5-Tetrahydroxypentyl] Dihydrogen Phosphate; C01068; D-Ribitol 5-Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H13O8P |
| Molecular Weight | 232.13 |
| CAS Registry Number | 51584-96-4 |
| SMILES | C(C(C(C(CO[P](=O)(O)O)O)O)O)O |
| InChI | 1S/C5H13O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h3-9H,1-2H2,(H2,10,11,12) |
| InChIKey | VJDOAZKNBQCAGE-UHFFFAOYSA-N |
| Density | 1.817g/cm3 (Cal.) |
|---|---|
| Boiling point | 619.759°C at 760 mmHg (Cal.) |
| Flash point | 328.619°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Polyribitol Phosphate |