|
CAS#: 51673-47-3 Product: 5-Methylmethadone No suppilers available for the product. |
| Name | 5-Methylmethadone |
|---|---|
| Synonyms | Erythro-5-Methylmethadone; 3-Heptanone, 6-(Dimethylamino)-5-Methyl-4,4-Diphenyl-, (R*,S*)-; 5-Methylmethadone |
| Molecular Structure | ![]() |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 |
| CAS Registry Number | 51673-47-3 |
| SMILES | [C@H](C(C(=O)CC)(C1=CC=CC=C1)C2=CC=CC=C2)([C@H](N(C)C)C)C |
| InChI | 1S/C22H29NO/c1-6-21(24)22(17(2)18(3)23(4)5,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-18H,6H2,1-5H3/t17-,18-/m1/s1 |
| InChIKey | ZUVMZXPYETWZQU-QZTJIDSGSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.586°C at 760 mmHg (Cal.) |
| Flash point | 129.33°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methylmethadone |