|
CAS#: 51688-32-5 Product: 4-[(4-Aminophenyl)Sulfonyl]-N,N-Diethylaniline No suppilers available for the product. |
| Name | 4-[(4-Aminophenyl)Sulfonyl]-N,N-Diethylaniline |
|---|---|
| Synonyms | 1N,1N-diethyl-4-(4-aminophenylsulfonyl)aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 |
| CAS Registry Number | 51688-32-5 |
| SMILES | CCN(CC)C1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)N |
| InChI | 1S/C16H20N2O2S/c1-3-18(4-2)14-7-11-16(12-8-14)21(19,20)15-9-5-13(17)6-10-15/h5-12H,3-4,17H2,1-2H3 |
| InChIKey | RPJZLSHJWIFXHY-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.7±35.0°C at 760 mmHg (Cal.) |
| Flash point | 260.9±25.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Aminophenyl)Sulfonyl]-N,N-Diethylaniline |