|
CAS#: 5173-05-7 Product: 1-(1,1':2',1''-Terbenzen-4-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(1,1':2',1''-Terbenzen-4-Yl)Ethanone |
|---|---|
| Synonyms | Nsc4053; 1-(1,1':2',1''-Terphenyl)-4-Ylethan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 |
| CAS Registry Number | 5173-05-7 |
| EINECS | 225-954-7 |
| SMILES | C1=CC=CC(=C1C2=CC=C(C(C)=O)C=C2)C3=CC=CC=C3 |
| InChI | 1S/C20H16O/c1-15(21)16-11-13-18(14-12-16)20-10-6-5-9-19(20)17-7-3-2-4-8-17/h2-14H,1H3 |
| InChIKey | DVQIELBBPKJSLS-UHFFFAOYSA-N |
| Density | 1.083g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.964°C at 760 mmHg (Cal.) |
| Flash point | 172.721°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,1':2',1''-Terbenzen-4-Yl)Ethanone |