|
CAS#: 51775-36-1 Product: Heptachlorobornane No suppilers available for the product. |
| Name | Heptachlorobornane |
|---|---|
| Synonyms | 2,2,5,6-Tetrachloro-1,7,7-Tris(Chloromethyl)Norbornane; 2,2,5-Endo,6-Exo,8,9,10-Heptachlorobornane; 5-Endo,6-Exo-2,2,5,6-Tetrachloro-1,7,7-Tris(Chloromethyl)-Bicyclo(2.2.1)Heptane |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11Cl7 |
| Molecular Weight | 379.37 |
| CAS Registry Number | 51775-36-1 |
| SMILES | C(C12C(C(CC1(Cl)Cl)C(C2Cl)Cl)(CCl)CCl)Cl |
| InChI | 1S/C10H11Cl7/c11-2-8(3-12)5-1-10(16,17)9(8,4-13)7(15)6(5)14/h5-7H,1-4H2 |
| InChIKey | IPVMCZLCKVSKGC-UHFFFAOYSA-N |
| Density | 1.58g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.626°C at 760 mmHg (Cal.) |
| Flash point | 225.753°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Heptachlorobornane |