|
CAS#: 51799-32-7 Product: D-N-Propylamphetamine No suppilers available for the product. |
| Name | D-N-Propylamphetamine |
|---|---|
| Synonyms | 1-Phenyl-N-Propyl-Propan-2-Amine Hydrochloride; (1-Methyl-2-Phenyl-Ethyl)-Propyl-Amine Hydrochloride; N-N-Propyl-Beta-Phenylisopropylaminhydrochlorid [German] |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20ClN |
| Molecular Weight | 213.75 |
| CAS Registry Number | 51799-32-7 |
| SMILES | [H+].C1=C(CC(NCCC)C)C=CC=C1.[Cl-] |
| InChI | 1S/C12H19N.ClH/c1-3-9-13-11(2)10-12-7-5-4-6-8-12;/h4-8,11,13H,3,9-10H2,1-2H3;1H |
| InChIKey | NSSZJVPOQFTJGR-UHFFFAOYSA-N |
| Boiling point | 254.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 103.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-N-Propylamphetamine |