|
CAS#: 5185-72-8 Product: [4-[2-Chloroethyl(Methyl)Amino]Phenyl]Arsonic Acid No suppilers available for the product. |
| Name | [4-[2-Chloroethyl(Methyl)Amino]Phenyl]Arsonic Acid |
|---|---|
| Synonyms | [4-(2-Chloroethyl-Methyl-Amino)Phenyl]Arsonic Acid; Brn 2841702; N-(2-Chloroethyl)-N-Methyl-P-Arsanilic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13AsClNO3 |
| Molecular Weight | 293.58 |
| CAS Registry Number | 5185-72-8 |
| SMILES | C1=CC(=CC=C1N(CCCl)C)[As](O)(O)=O |
| InChI | 1S/C9H13AsClNO3/c1-12(7-6-11)9-4-2-8(3-5-9)10(13,14)15/h2-5H,6-7H2,1H3,(H2,13,14,15) |
| InChIKey | IFUZYDZFQPYFIU-UHFFFAOYSA-N |
| Boiling point | 514.771°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 265.124°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-[2-Chloroethyl(Methyl)Amino]Phenyl]Arsonic Acid |