|
CAS#: 51869-30-8 Product: Ristosamine No suppilers available for the product. |
| Name | Ristosamine |
|---|---|
| Synonyms | (3R,4R,5S)-3-Amino-4,5-Dihydroxy-Hexanal; 3-Amino-2,3,6-Trideoxy-L-Ribo-Hexose; Ristosamine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 |
| CAS Registry Number | 51869-30-8 |
| SMILES | [C@@H](CC=O)([C@H]([C@H](C)O)O)N |
| InChI | 1S/C6H13NO3/c1-4(9)6(10)5(7)2-3-8/h3-6,9-10H,2,7H2,1H3/t4-,5+,6-/m0/s1 |
| InChIKey | WPJRFCZKZXBUNI-JKUQZMGJSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.988°C at 760 mmHg (Cal.) |
| Flash point | 162.443°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ristosamine |