|
CAS#: 5188-73-8 Product: Axillarin No suppilers available for the product. |
| Name | Axillarin |
|---|---|
| Synonyms | 2-(3,4-Dihydroxyphenyl)-5,7-Dihydroxy-3,6-Dimethoxy-Chromen-4-One; 2-(3,4-Dihydroxyphenyl)-5,7-Dihydroxy-3,6-Dimethoxy-4-Chromenone; 2-(3,4-Dihydroxyphenyl)-5,7-Dihydroxy-3,6-Dimethoxy-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14O8 |
| Molecular Weight | 346.29 |
| CAS Registry Number | 5188-73-8 |
| SMILES | C2=C1OC(=C(C(C1=C(C(=C2O)OC)O)=O)OC)C3=CC(=C(C=C3)O)O |
| InChI | 1S/C17H14O8/c1-23-16-10(20)6-11-12(13(16)21)14(22)17(24-2)15(25-11)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
| InChIKey | KIGVXRGRNLQNNI-UHFFFAOYSA-N |
| Density | 1.659g/cm3 (Cal.) |
|---|---|
| Boiling point | 684.662°C at 760 mmHg (Cal.) |
| Flash point | 255.637°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Axillarin |