|
CAS#: 519156-98-0 Product: 2,4,5-Tris(2-Nitrophenyl)-4,5-Dihydro-1H-Imidazole No suppilers available for the product. |
| Name | 2,4,5-Tris(2-Nitrophenyl)-4,5-Dihydro-1H-Imidazole |
|---|---|
| Synonyms | 1H-Imidazole, 4,5-dihydro-2,4,5-tris(2-nitrophenyl)-; 2,4,5-Tris(2-nitrophenyl)-4,5-dihydro-1H-imidazol; 2,4,5-Tris(2-nitrophenyl)-4,5-dihydro-1H-imidazole |
| Molecular Structure | ![]() |
| Molecular Formula | C21H15N5O6 |
| Molecular Weight | 433.37 |
| CAS Registry Number | 519156-98-0 |
| SMILES | c1ccc(c(c1)C2C(N=C(N2)c3ccccc3[N+](=O)[O-])c4ccccc4[N+](=O)[O-])[N+](=O)[O-] |
| InChI | 1S/C21H15N5O6/c27-24(28)16-10-4-1-7-13(16)19-20(14-8-2-5-11-17(14)25(29)30)23-21(22-19)15-9-3-6-12-18(15)26(31)32/h1-12,19-20H,(H,22,23) |
| InChIKey | NAAUIZGGOJFOGE-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 611.1±65.0°C at 760 mmHg (Cal.) |
| Flash point | 323.4±34.3°C (Cal.) |
| Refractive index | 1.728 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5-Tris(2-Nitrophenyl)-4,5-Dihydro-1H-Imidazole |