Online Database of Chemicals from Around the World
| Name | N,N'-Bis(2,4,6-Tribromophenyl)Adipamide |
|---|---|
| Synonyms | N,N'-Bis(2,4,6-Tribromophenyl)Adipamide |
| Molecular Structure |  |
| Molecular Formula | C18H14Br6N2O2 |
| Molecular Weight | 769.74 |
| CAS Registry Number | 51937-18-9 |
| EINECS | 257-528-1 |
| SMILES | C1=C(Br)C=C(Br)C(=C1Br)NC(=O)CCCCC(=O)NC2=C(Br)C=C(Br)C=C2Br |
| InChI | 1S/C18H14Br6N2O2/c19-9-5-11(21)17(12(22)6-9)25-15(27)3-1-2-4-16(28)26-18-13(23)7-10(20)8-14(18)24/h5-8H,1-4H2,(H,25,27)(H,26,28) |
| InChIKey | LOONXPZWUBCFHH-UHFFFAOYSA-N |
| Density | 2.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 726.846°C at 760 mmHg (Cal.) |
| Flash point | 393.383°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Bis(2,4,6-Tribromophenyl)Adipamide |
