|
CAS#: 51971-64-3 Product: 3,5-Dichlorophthalic Anhydride No suppilers available for the product. |
| Name | 3,5-Dichlorophthalic Anhydride |
|---|---|
| Synonyms | 4,6-Dichloroisobenzofuran-1,3-Dione; 4,6-Dichloroisobenzofuran-1,3-Quinone; 1,3-Isobenzofurandione, 4,6-Dichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H2Cl2O3 |
| Molecular Weight | 217.01 |
| CAS Registry Number | 51971-64-3 |
| EINECS | 257-565-3 |
| SMILES | C1=C(Cl)C2=C(C=C1Cl)C(OC2=O)=O |
| InChI | 1S/C8H2Cl2O3/c9-3-1-4-6(5(10)2-3)8(12)13-7(4)11/h1-2H |
| InChIKey | HIOZXJLZFVEQCC-UHFFFAOYSA-N |
| Density | 1.716g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.807°C at 760 mmHg (Cal.) |
| Flash point | 151.951°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dichlorophthalic Anhydride |