|
CAS#: 5202-38-0 Product: Methyl 4,8-Dioxo-2-Adamantanecarboxylate No suppilers available for the product. |
| Name | Methyl 4,8-Dioxo-2-Adamantanecarboxylate |
|---|---|
| Synonyms | Methyl 4,8-dioxo-2-adamantanecarboxylate # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 5202-38-0 |
| SMILES | O=C1C3CC2C(=O)C(CC1C2)C3C(=O)OC |
| InChI | 1S/C12H14O4/c1-16-12(15)9-7-3-5-2-6(11(7)14)4-8(9)10(5)13/h5-9H,2-4H2,1H3 |
| InChIKey | PLMQPUSQIPZMCP-UHFFFAOYSA-N |
| Density | 1.307g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.162°C at 760 mmHg (Cal.) |
| Flash point | 162.668°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4,8-Dioxo-2-Adamantanecarboxylate |