|
CAS#: 52101-49-2 Product: 3,4-Diphenyl-5-Nitro-2-Acetylfuran No suppilers available for the product. |
| Name | 3,4-Diphenyl-5-Nitro-2-Acetylfuran |
|---|---|
| Synonyms | 1-[5-Nitro-3,4-Di(Phenyl)-2-Furyl]Ethanone; 3,4-Diphenyl-5-Nitro-2-Acetylfuran; Ccris 2155 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 |
| CAS Registry Number | 52101-49-2 |
| SMILES | C3=C(C1=C(OC(=C1C2=CC=CC=C2)C(=O)C)[N+]([O-])=O)C=CC=C3 |
| InChI | 1S/C18H13NO4/c1-12(20)17-15(13-8-4-2-5-9-13)16(18(23-17)19(21)22)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | DJUQPRHVVNQSIS-UHFFFAOYSA-N |
| Density | 1.248g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.953°C at 760 mmHg (Cal.) |
| Flash point | 212.619°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Diphenyl-5-Nitro-2-Acetylfuran |