|
CAS#: 521087-51-4 Product: (3R)-3-Nitro-2-Pentanone No suppilers available for the product. |
| Name | (3R)-3-Nitro-2-Pentanone |
|---|---|
| Synonyms | 2-Pentanone, 3-nitro-, (3R)- |
| Molecular Structure | ![]() |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 |
| CAS Registry Number | 521087-51-4 |
| SMILES | CC[C@H](C(=O)C)[N+](=O)[O-] |
| InChI | 1S/C5H9NO3/c1-3-5(4(2)7)6(8)9/h5H,3H2,1-2H3/t5-/m1/s1 |
| InChIKey | MNUXBOINOHRRST-RXMQYKEDSA-N |
| Density | 1.081g/cm3 (Cal.) |
|---|---|
| Boiling point | 186.668°C at 760 mmHg (Cal.) |
| Flash point | 68.846°C (Cal.) |
| Refractive index | 1.428 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R)-3-Nitro-2-Pentanone |