|
CAS#: 52135-26-9 Product: 1,3,3,4,5,6,7-Heptachloro-3H-Isoindole No suppilers available for the product. |
| Name | 1,3,3,4,5,6,7-Heptachloro-3H-Isoindole |
|---|---|
| Synonyms | 1H-Isoindole, 1,1,3,4,5,6,7-Heptachloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C8Cl7N |
| Molecular Weight | 358.27 |
| CAS Registry Number | 52135-26-9 |
| SMILES | C1(=C(Cl)C(=C(C2=C1C(=NC2(Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C8Cl7N/c9-3-1-2(4(10)6(12)5(3)11)8(14,15)16-7(1)13 |
| InChIKey | FXRBYDKQFPIWTH-UHFFFAOYSA-N |
| Density | 1.994g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.715°C at 760 mmHg (Cal.) |
| Flash point | 207.031°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,3,4,5,6,7-Heptachloro-3H-Isoindole |