|
CAS#: 52181-96-1 Product: Pentachlorobiphenylol No suppilers available for the product. |
| Name | Pentachlorobiphenylol |
|---|---|
| Synonyms | (1,1'-Biphenyl)Ol, Pentachloro-; Pentachloro-(1,1'-Biphenyl)-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H5Cl5O |
| Molecular Weight | 342.44 |
| CAS Registry Number | 52181-96-1 |
| SMILES | C1=C(C(=CC=C1)C2=C(C(=C(C(=C2O)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H5Cl5O/c13-6-4-2-1-3-5(6)7-8(14)9(15)10(16)11(17)12(7)18/h1-4,18H |
| InChIKey | LAPUREOIFIODEI-UHFFFAOYSA-N |
| Density | 1.608g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.461°C at 760 mmHg (Cal.) |
| Flash point | 183.896°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentachlorobiphenylol |