|
CAS#: 521917-66-8 Product: 3-Bromo-6-Methoxy-1,2-Dihydronaphthalene No suppilers available for the product. |
| Name | 3-Bromo-6-Methoxy-1,2-Dihydronaphthalene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H11BrO |
| Molecular Weight | 239.11 |
| CAS Registry Number | 521917-66-8 |
| SMILES | Br\C2=C\c1c(ccc(OC)c1)CC2 |
| InChI | 1S/C11H11BrO/c1-13-11-5-3-8-2-4-10(12)6-9(8)7-11/h3,5-7H,2,4H2,1H3 |
| InChIKey | JJRLJTJZVTWBQX-UHFFFAOYSA-N |
| Density | 1.441g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.931°C at 760 mmHg (Cal.) |
| Flash point | 124.167°C (Cal.) |
| Refractive index | 1.604 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-6-Methoxy-1,2-Dihydronaphthalene |